About bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+)
bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) (PubChem CID 59254140) has the molecular formula C12H14N4Pt
and a molecular weight of 409.35 g/mol. Its IUPAC name is bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+).
Molecular Properties
| Compound Name | bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) |
| PubChem CID | 59254140 |
| Molecular Formula | C12H14N4Pt |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) |
| SMILES | C/N=C/c1ccc[n-]1.C/N=C/c1ccc[n-]1.[Pt+2] |
| InChI | InChI=1S/2C6H7N2.Pt/c2*1-7-5-6-3-2-4-8-6;/h2*2-5H,1H3;/q2*-1;+2/b2*7-5+; |
| InChIKey | JFFVCEUNLUIFEU-XXXYRMOLSA-N |
| XLogP | 1.38 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+)?
The IUPAC name of bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) (CID 59254140) is bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+).
What is the SMILES notation for bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+)?
The canonical SMILES for bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) is C/N=C/c1ccc[n-]1.C/N=C/c1ccc[n-]1.[Pt+2].
What is the InChIKey of bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+)?
The InChIKey is JFFVCEUNLUIFEU-XXXYRMOLSA-N. The full InChI is InChI=1S/2C6H7N2.Pt/c2*1-7-5-6-3-2-4-8-6;/h2*2-5H,1H3;/q2*-1;+2/b2*7-5+;.
What are the key properties of bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+)?
bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) has a molecular weight of 409.35 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-methyl-1-pyrrol-1-id-2-ylmethanimine);platinum(2+) is sourced from PubChem (CID 59254140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).