C13H20O6 — CID 59254166
(5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate (PubChem CID 59254166) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | (5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59254166 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C(O)C(O)CC12 |
| InChI | InChI=1S/C13H20O6/c1-4-13(2,3)12(17)19-10-6-5-7(14)8(15)9(6)18-11(10)16/h6-10,14-15H,4-5H2,1-3H3 |
| InChIKey | VNWPPYSALTUFIL-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |