About 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one
5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one (PubChem CID 59254193) has the molecular formula C8H11ClO2
and a molecular weight of 174.63 g/mol. Its IUPAC name is 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one |
| PubChem CID | 59254193 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one |
| SMILES | CC1=C(Cl)C(=O)OC(C)C1C |
| InChI | InChI=1S/C8H11ClO2/c1-4-5(2)7(9)8(10)11-6(4)3/h4,6H,1-3H3 |
| InChIKey | AKYBWGVQSAGFAH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one?
The IUPAC name of 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one (CID 59254193) is 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one?
The canonical SMILES for 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one is CC1=C(Cl)C(=O)OC(C)C1C.
What is the InChIKey of 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one?
The InChIKey is AKYBWGVQSAGFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClO2/c1-4-5(2)7(9)8(10)11-6(4)3/h4,6H,1-3H3.
What are the key properties of 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one?
5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one has a molecular weight of 174.63 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3,4-trimethyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 59254193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).