methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate

C6H9F2NO2 — CID 59254339

IUPACmethyl (2R)-4,4-difluoropyrrolidine-2-carboxylate
SMILESCOC(=O)[C@H]1CC(F)(F)CN1
InChIInChI=1S/C6H9F2NO2/c1-11-5(10)4-2-6(7,8)3-9-4/h4,9H,2-3H2,1H3/t4-/m1/s1
InChIKeyRPYSGPRTWAWWKK-SCSAIBSYSA-N
MW165.14 g/mol
LogP0.16
Rot. Bonds1

About methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate

methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate (PubChem CID 59254339) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2R)-4,4-difluoropyrrolidine-2-carboxylate
PubChem CID59254339
Molecular FormulaC6H9F2NO2
Molecular Weight165.14 g/mol
Exact Mass165.06
IUPAC Namemethyl (2R)-4,4-difluoropyrrolidine-2-carboxylate
SMILESCOC(=O)[C@H]1CC(F)(F)CN1
InChIInChI=1S/C6H9F2NO2/c1-11-5(10)4-2-6(7,8)3-9-4/h4,9H,2-3H2,1H3/t4-/m1/s1
InChIKeyRPYSGPRTWAWWKK-SCSAIBSYSA-N
XLogP0.16
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.14
LogP ≤ 50.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate?
The IUPAC name of methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate (CID 59254339) is methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate is COC(=O)[C@H]1CC(F)(F)CN1.
What is the InChIKey of methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate?
The InChIKey is RPYSGPRTWAWWKK-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9F2NO2/c1-11-5(10)4-2-6(7,8)3-9-4/h4,9H,2-3H2,1H3/t4-/m1/s1.
What are the key properties of methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate?
methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate has a molecular weight of 165.14 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-4,4-difluoropyrrolidine-2-carboxylate is sourced from PubChem (CID 59254339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).