C24H37NO3Si — CID 59254821
(4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one (PubChem CID 59254821) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59254821 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-prop-1-en-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H]1OC(=O)N(Cc2ccccc2)[C@]1(CO[Si](C)(C)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C24H37NO3Si/c1-18(2)21-24(20-14-11-15-20,17-27-29(6,7)23(3,4)5)25(22(26)28-21)16-19-12-9-8-10-13-19/h8-10,12-13,20-21H,1,11,14-17H2,2-7H3/t21-,24-/m1/s1 |
| InChIKey | DIFLUSHVMNVRQA-ZJSXRUAMSA-N |
| XLogP | 6.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|