About tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate
tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 59256018) has the molecular formula C18H23Cl2NO3
and a molecular weight of 372.29 g/mol. Its IUPAC name is tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 59256018 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(c3ccc(Cl)c(Cl)c3)C(CO)[C@@H]2C1 |
| InChI | InChI=1S/C18H23Cl2NO3/c1-17(2,3)24-16(23)21-7-6-18(12(9-21)13(18)10-22)11-4-5-14(19)15(20)8-11/h4-5,8,12-13,22H,6-7,9-10H2,1-3H3/t12-,13?,18?/m0/s1 |
| InChIKey | FZKMTCRNLPKWKT-ZVLZOBCMSA-N |
| XLogP | 4.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate (CID 59256018) is tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate is CC(C)(C)OC(=O)N1CCC2(c3ccc(Cl)c(Cl)c3)C(CO)[C@@H]2C1.
What is the InChIKey of tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is FZKMTCRNLPKWKT-ZVLZOBCMSA-N. The full InChI is InChI=1S/C18H23Cl2NO3/c1-17(2,3)24-16(23)21-7-6-18(12(9-21)13(18)10-22)11-4-5-14(19)15(20)8-11/h4-5,8,12-13,22H,6-7,9-10H2,1-3H3/t12-,13?,18?/m0/s1.
What are the key properties of tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate?
tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 372.29 g/mol, XLogP of 4.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1S)-6-(3,4-dichlorophenyl)-7-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 59256018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).