C15H17ClF3NO — CID 59256025
(1R)-6-[3-chloro-4-(trifluoromethyl)phenyl]-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane (PubChem CID 59256025) has the molecular formula C15H17ClF3NO and a molecular weight of 319.75 g/mol. Its IUPAC name is (1R)-6-[3-chloro-4-(trifluoromethyl)phenyl]-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R)-6-[3-chloro-4-(trifluoromethyl)phenyl]-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 59256025 |
| Molecular Formula | C15H17ClF3NO |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (1R)-6-[3-chloro-4-(trifluoromethyl)phenyl]-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane |
| SMILES | COC[C@@]12CNCCC1(c1ccc(C(F)(F)F)c(Cl)c1)C2 |
| InChI | InChI=1S/C15H17ClF3NO/c1-21-9-13-7-14(13,4-5-20-8-13)10-2-3-11(12(16)6-10)15(17,18)19/h2-3,6,20H,4-5,7-9H2,1H3/t13-,14?/m1/s1 |
| InChIKey | KXJGGCUESGCVLH-KWCCSABGSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |