C9H8N2O2 — CID 59256580
8-hydroxy-6-methyl-1,6-naphthyridin-5-one (PubChem CID 59256580) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 8-hydroxy-6-methyl-1,6-naphthyridin-5-one.
| Compound Name | 8-hydroxy-6-methyl-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 59256580 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 8-hydroxy-6-methyl-1,6-naphthyridin-5-one |
| SMILES | Cn1cc(O)c2ncccc2c1=O |
| InChI | InChI=1S/C9H8N2O2/c1-11-5-7(12)8-6(9(11)13)3-2-4-10-8/h2-5,12H,1H3 |
| InChIKey | RWYJAENXYKMBBD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |