About 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde
9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 59256591) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| PubChem CID | 59256591 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | O=Cc1cnc2c(O)cccn2c1=O |
| InChI | InChI=1S/C9H6N2O3/c12-5-6-4-10-8-7(13)2-1-3-11(8)9(6)14/h1-5,13H |
| InChIKey | PQKPDPAPAQUPDO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The IUPAC name of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (CID 59256591) is 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
What is the SMILES notation for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The canonical SMILES for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde is O=Cc1cnc2c(O)cccn2c1=O.
What is the InChIKey of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
The InChIKey is PQKPDPAPAQUPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-5-6-4-10-8-7(13)2-1-3-11(8)9(6)14/h1-5,13H.
What are the key properties of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde?
9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde has a molecular weight of 190.16 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde is sourced from PubChem (CID 59256591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).