About 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one
6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one (PubChem CID 59256597) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one |
| PubChem CID | 59256597 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one |
| SMILES | NCc1ccc2oc(=O)cc(O)c2n1 |
| InChI | InChI=1S/C9H8N2O3/c10-4-5-1-2-7-9(11-5)6(12)3-8(13)14-7/h1-3,12H,4,10H2 |
| InChIKey | MTKZZZAYTPTXKY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one?
The IUPAC name of 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one (CID 59256597) is 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one.
What is the SMILES notation for 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one?
The canonical SMILES for 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one is NCc1ccc2oc(=O)cc(O)c2n1.
What is the InChIKey of 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one?
The InChIKey is MTKZZZAYTPTXKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c10-4-5-1-2-7-9(11-5)6(12)3-8(13)14-7/h1-3,12H,4,10H2.
What are the key properties of 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one?
6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one has a molecular weight of 192.17 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-4-hydroxypyrano[3,2-b]pyridin-2-one is sourced from PubChem (CID 59256597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).