About pyrido[4,3-d]pyrimidin-8-ol
pyrido[4,3-d]pyrimidin-8-ol (PubChem CID 59256622) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is pyrido[4,3-d]pyrimidin-8-ol.
Molecular Properties
| Compound Name | pyrido[4,3-d]pyrimidin-8-ol |
| PubChem CID | 59256622 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | pyrido[4,3-d]pyrimidin-8-ol |
| SMILES | Oc1cncc2cncnc12 |
| InChI | InChI=1S/C7H5N3O/c11-6-3-8-1-5-2-9-4-10-7(5)6/h1-4,11H |
| InChIKey | OZEKJQSONBSKRW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrido[4,3-d]pyrimidin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[4,3-d]pyrimidin-8-ol?
The IUPAC name of pyrido[4,3-d]pyrimidin-8-ol (CID 59256622) is pyrido[4,3-d]pyrimidin-8-ol.
What is the SMILES notation for pyrido[4,3-d]pyrimidin-8-ol?
The canonical SMILES for pyrido[4,3-d]pyrimidin-8-ol is Oc1cncc2cncnc12.
What is the InChIKey of pyrido[4,3-d]pyrimidin-8-ol?
The InChIKey is OZEKJQSONBSKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c11-6-3-8-1-5-2-9-4-10-7(5)6/h1-4,11H.
What are the key properties of pyrido[4,3-d]pyrimidin-8-ol?
pyrido[4,3-d]pyrimidin-8-ol has a molecular weight of 147.14 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[4,3-d]pyrimidin-8-ol is sourced from PubChem (CID 59256622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).