C9H9N3O — CID 59256730
7-(aminomethyl)-1H-1,5-naphthyridin-4-one (PubChem CID 59256730) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 7-(aminomethyl)-1H-1,5-naphthyridin-4-one.
| Compound Name | 7-(aminomethyl)-1H-1,5-naphthyridin-4-one |
|---|---|
| PubChem CID | 59256730 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 7-(aminomethyl)-1H-1,5-naphthyridin-4-one |
| SMILES | NCc1cnc2c(=O)cc[nH]c2c1 |
| InChI | InChI=1S/C9H9N3O/c10-4-6-3-7-9(12-5-6)8(13)1-2-11-7/h1-3,5H,4,10H2,(H,11,13) |
| InChIKey | OLCDBMDRPQRURN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |