C14H20F8O3 — CID 59257512
3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane (PubChem CID 59257512) has the molecular formula C14H20F8O3 and a molecular weight of 388.30 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane.
| Compound Name | 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 59257512 |
| Molecular Formula | C14H20F8O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(2-methoxyethoxymethoxy)-1-(trifluoromethyl)cyclopentane |
| SMILES | CCC1CC(OCOCCOC)(C(F)(F)F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C14H20F8O3/c1-4-9-7-11(14(20,21)22,25-8-24-6-5-23-3)13(18,19)12(9,17)10(2,15)16/h9H,4-8H2,1-3H3 |
| InChIKey | YEANVLLIQUYTRV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|