C18H32O4 — CID 59257760
(E,4R,7S,8R,9R)-7-ethyl-8-hydroxy-4-(hydroxymethyl)-5,9-dimethyltridec-11-ene-3,6-dione (PubChem CID 59257760) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (E,4R,7S,8R,9R)-7-ethyl-8-hydroxy-4-(hydroxymethyl)-5,9-dimethyltridec-11-ene-3,6-dione.
| Compound Name | (E,4R,7S,8R,9R)-7-ethyl-8-hydroxy-4-(hydroxymethyl)-5,9-dimethyltridec-11-ene-3,6-dione |
|---|---|
| PubChem CID | 59257760 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (E,4R,7S,8R,9R)-7-ethyl-8-hydroxy-4-(hydroxymethyl)-5,9-dimethyltridec-11-ene-3,6-dione |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H](CC)C(=O)C(C)[C@H](CO)C(=O)CC |
| InChI | InChI=1S/C18H32O4/c1-6-9-10-12(4)17(21)14(7-2)18(22)13(5)15(11-19)16(20)8-3/h6,9,12-15,17,19,21H,7-8,10-11H2,1-5H3/b9-6+/t12-,13?,14+,15+,17-/m1/s1 |
| InChIKey | WLISFDZDEQJIMT-BIXDEYEBSA-N |
| XLogP | 2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|