About ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate
ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate (PubChem CID 592579) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate |
| PubChem CID | 592579 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate |
| SMILES | CCOC(=O)N1C2CC3OC2CCC1C3O |
| InChI | InChI=1S/C11H17NO4/c1-2-15-11(14)12-6-3-4-8-7(12)5-9(16-8)10(6)13/h6-10,13H,2-5H2,1H3 |
| InChIKey | MSKWTBKFSBBWPE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate?
The IUPAC name of ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate (CID 592579) is ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate.
What is the SMILES notation for ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate?
The canonical SMILES for ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate is CCOC(=O)N1C2CC3OC2CCC1C3O.
What is the InChIKey of ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate?
The InChIKey is MSKWTBKFSBBWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-2-15-11(14)12-6-3-4-8-7(12)5-9(16-8)10(6)13/h6-10,13H,2-5H2,1H3.
What are the key properties of ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate?
ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate has a molecular weight of 227.26 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 10-hydroxy-2-oxa-7-azatricyclo[4.3.1.03,8]decane-7-carboxylate is sourced from PubChem (CID 592579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).