About 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one
2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 59259010) has the molecular formula C18H19N5O3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 59259010 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccc(-c2cc3c(C)nc(N)nc3n(C3CCOC3)c2=O)cn1 |
| InChI | InChI=1S/C18H19N5O3/c1-10-13-7-14(11-3-4-15(25-2)20-8-11)17(24)23(12-5-6-26-9-12)16(13)22-18(19)21-10/h3-4,7-8,12H,5-6,9H2,1-2H3,(H2,19,21,22) |
| InChIKey | SSOLRNZHGLSQCN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one (CID 59259010) is 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one is COc1ccc(-c2cc3c(C)nc(N)nc3n(C3CCOC3)c2=O)cn1.
What is the InChIKey of 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is SSOLRNZHGLSQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O3/c1-10-13-7-14(11-3-4-15(25-2)20-8-11)17(24)23(12-5-6-26-9-12)16(13)22-18(19)21-10/h3-4,7-8,12H,5-6,9H2,1-2H3,(H2,19,21,22).
What are the key properties of 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one?
2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 353.38 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(6-methoxy-3-pyridinyl)-4-methyl-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 59259010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).