C14H25NO — CID 59259582
1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2,2-dimethylpropan-1-one (PubChem CID 59259582) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59259582 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-[(1R,2S)-1-(tert-butylamino)-2-ethenylcyclopropyl]-2,2-dimethylpropan-1-one |
| SMILES | C=C[C@@H]1C[C@]1(NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-8-10-9-14(10,15-13(5,6)7)11(16)12(2,3)4/h8,10,15H,1,9H2,2-7H3/t10-,14-/m1/s1 |
| InChIKey | ZZAWQHILLFIKMF-QMTHXVAHSA-N |
| XLogP | 2.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|