C9H7F7O — CID 59259641
1-but-3-enoxy-2,3,3,4,4,5,5-heptafluorocyclopentene (PubChem CID 59259641) has the molecular formula C9H7F7O and a molecular weight of 264.14 g/mol. Its IUPAC name is 1-but-3-enoxy-2,3,3,4,4,5,5-heptafluorocyclopentene.
| Compound Name | 1-but-3-enoxy-2,3,3,4,4,5,5-heptafluorocyclopentene |
|---|---|
| PubChem CID | 59259641 |
| Molecular Formula | C9H7F7O |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1-but-3-enoxy-2,3,3,4,4,5,5-heptafluorocyclopentene |
| SMILES | C=CCCOC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H7F7O/c1-2-3-4-17-6-5(10)7(11,12)9(15,16)8(6,13)14/h2H,1,3-4H2 |
| InChIKey | LEWPTLXFUJDZPB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|