C19H14ClN5O2S — CID 59260077
5-chloro-N-[[1-[3-(2-oxo-1-pyridinyl)phenyl]triazol-4-yl]methyl]thiophene-2-carboxamide (PubChem CID 59260077) has the molecular formula C19H14ClN5O2S and a molecular weight of 411.87 g/mol. Its IUPAC name is 5-chloro-N-[[1-[3-(2-oxo-1-pyridinyl)phenyl]triazol-4-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[1-[3-(2-oxo-1-pyridinyl)phenyl]triazol-4-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59260077 |
| Molecular Formula | C19H14ClN5O2S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 5-chloro-N-[[1-[3-(2-oxo-1-pyridinyl)phenyl]triazol-4-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cn(-c2cccc(-n3ccccc3=O)c2)nn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H14ClN5O2S/c20-17-8-7-16(28-17)19(27)21-11-13-12-25(23-22-13)15-5-3-4-14(10-15)24-9-2-1-6-18(24)26/h1-10,12H,11H2,(H,21,27) |
| InChIKey | BEAPTKNMNBFOJD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |