C48H48F6N6O6 — CID 59260145
5-[3,5-bis[3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazole (PubChem CID 59260145) has the molecular formula C48H48F6N6O6 and a molecular weight of 918.94 g/mol. Its IUPAC name is 5-[3,5-bis[3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[3,5-bis[3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 59260145 |
| Molecular Formula | C48H48F6N6O6 |
| Molecular Weight | 918.94 g/mol |
| Exact Mass | 918.35 |
| IUPAC Name | 5-[3,5-bis[3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]-3-(2,3-difluoro-4-hexoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCCCCCOc1ccc(-c2noc(-c3cc(-c4nc(-c5ccc(OCCCCCC)c(F)c5F)no4)cc(-c4nc(-c5ccc(OCCCCCC)c(F)c5F)no4)c3)n2)c(F)c1F |
| InChI | InChI=1S/C48H48F6N6O6/c1-4-7-10-13-22-61-34-19-16-31(37(49)40(34)52)43-55-46(64-58-43)28-25-29(47-56-44(59-65-47)32-17-20-35(41(53)38(32)50)62-23-14-11-8-5-2)27-30(26-28)48-57-45(60-66-48)33-18-21-36(42(54)39(33)51)63-24-15-12-9-6-3/h16-21,25-27H,4-15,22-24H2,1-3H3 |
| InChIKey | CLOFTGJPAJLSKH-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 144.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.94 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|