C13H13F3N4O — CID 59261079
4-(1H-imidazol-5-ylmethyl)-8-(trifluoromethyl)-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 59261079) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylmethyl)-8-(trifluoromethyl)-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | 4-(1H-imidazol-5-ylmethyl)-8-(trifluoromethyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 59261079 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-(1H-imidazol-5-ylmethyl)-8-(trifluoromethyl)-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | Nc1cc2c(c(C(F)(F)F)c1)OCCN2Cc1cnc[nH]1 |
| InChI | InChI=1S/C13H13F3N4O/c14-13(15,16)10-3-8(17)4-11-12(10)21-2-1-20(11)6-9-5-18-7-19-9/h3-5,7H,1-2,6,17H2,(H,18,19) |
| InChIKey | LIXLHUWGKGPKNG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|