C25H25N3O3 — CID 59261166
tert-butyl 7-(benzhydrylideneamino)-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate (PubChem CID 59261166) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl 7-(benzhydrylideneamino)-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate.
| Compound Name | tert-butyl 7-(benzhydrylideneamino)-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 59261166 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tert-butyl 7-(benzhydrylideneamino)-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2cnc(N=C(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C25H25N3O3/c1-25(2,3)31-24(29)28-14-15-30-21-17-26-22(16-20(21)28)27-23(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | DFLPIRPLKQUOQS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|