About tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate
tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 59261296) has the molecular formula C21H26N2O3
and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| PubChem CID | 59261296 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| SMILES | CCN(c1ccccc1)c1ccc2c(c1)N(C(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C21H26N2O3/c1-5-22(16-9-7-6-8-10-16)17-11-12-19-18(15-17)23(13-14-25-19)20(24)26-21(2,3)4/h6-12,15H,5,13-14H2,1-4H3 |
| InChIKey | NLLPSZLVDFQXQL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The IUPAC name of tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate (CID 59261296) is tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
What is the SMILES notation for tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The canonical SMILES for tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate is CCN(c1ccccc1)c1ccc2c(c1)N(C(=O)OC(C)(C)C)CCO2.
What is the InChIKey of tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
The InChIKey is NLLPSZLVDFQXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3/c1-5-22(16-9-7-6-8-10-16)17-11-12-19-18(15-17)23(13-14-25-19)20(24)26-21(2,3)4/h6-12,15H,5,13-14H2,1-4H3.
What are the key properties of tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate?
tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate has a molecular weight of 354.45 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(N-ethylanilino)-2,3-dihydro-1,4-benzoxazine-4-carboxylate is sourced from PubChem (CID 59261296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).