C14H16FN5O2 — CID 59261324
8-fluoro-4-(1H-imidazol-5-ylmethyl)-N'-methoxy-2,3-dihydro-1,4-benzoxazine-6-carboximidamide (PubChem CID 59261324) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is 8-fluoro-4-(1H-imidazol-5-ylmethyl)-N'-methoxy-2,3-dihydro-1,4-benzoxazine-6-carboximidamide.
| Compound Name | 8-fluoro-4-(1H-imidazol-5-ylmethyl)-N'-methoxy-2,3-dihydro-1,4-benzoxazine-6-carboximidamide |
|---|---|
| PubChem CID | 59261324 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 8-fluoro-4-(1H-imidazol-5-ylmethyl)-N'-methoxy-2,3-dihydro-1,4-benzoxazine-6-carboximidamide |
| SMILES | CO/N=C(\N)c1cc(F)c2c(c1)N(Cc1cnc[nH]1)CCO2 |
| InChI | InChI=1S/C14H16FN5O2/c1-21-19-14(16)9-4-11(15)13-12(5-9)20(2-3-22-13)7-10-6-17-8-18-10/h4-6,8H,2-3,7H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | AOAXZEIPHIIVIO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|