About (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine
(2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine (PubChem CID 59261829) has the molecular formula C25H23Cl2N3
and a molecular weight of 436.39 g/mol. Its IUPAC name is (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine.
Molecular Properties
| Compound Name | (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine |
| PubChem CID | 59261829 |
| Molecular Formula | C25H23Cl2N3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine |
| SMILES | [C-]#[N+]c1ccc(CN2C[C@@H](C)N(c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C25H23Cl2N3/c1-18-15-29(16-19-3-11-23(28-2)12-4-19)17-25(20-5-7-21(26)8-6-20)30(18)24-13-9-22(27)10-14-24/h3-14,18,25H,15-17H2,1H3/t18-,25+/m1/s1 |
| InChIKey | LPYVRWGMTAKMNQ-CJAUYULYSA-N |
| XLogP | 7.00 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine?
The IUPAC name of (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine (CID 59261829) is (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine.
What is the SMILES notation for (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine?
The canonical SMILES for (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine is [C-]#[N+]c1ccc(CN2C[C@@H](C)N(c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)C2)cc1.
What is the InChIKey of (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine?
The InChIKey is LPYVRWGMTAKMNQ-CJAUYULYSA-N. The full InChI is InChI=1S/C25H23Cl2N3/c1-18-15-29(16-19-3-11-23(28-2)12-4-19)17-25(20-5-7-21(26)8-6-20)30(18)24-13-9-22(27)10-14-24/h3-14,18,25H,15-17H2,1H3/t18-,25+/m1/s1.
What are the key properties of (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine?
(2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine has a molecular weight of 436.39 g/mol, XLogP of 7.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-1,2-bis(4-chlorophenyl)-4-[(4-isocyanophenyl)methyl]-6-methylpiperazine is sourced from PubChem (CID 59261829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).