C26H28FN3O — CID 59262227
3-(4-fluorophenyl)-N-methyl-N-[4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]benzamide (PubChem CID 59262227) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-methyl-N-[4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]benzamide.
| Compound Name | 3-(4-fluorophenyl)-N-methyl-N-[4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59262227 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-(4-fluorophenyl)-N-methyl-N-[4-[[(3S)-3-methylpiperazin-1-yl]methyl]phenyl]benzamide |
| SMILES | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3cccc(-c4ccc(F)cc4)c3)cc2)CCN1 |
| InChI | InChI=1S/C26H28FN3O/c1-19-17-30(15-14-28-19)18-20-6-12-25(13-7-20)29(2)26(31)23-5-3-4-22(16-23)21-8-10-24(27)11-9-21/h3-13,16,19,28H,14-15,17-18H2,1-2H3/t19-/m0/s1 |
| InChIKey | YHONSAIXWFVELO-IBGZPJMESA-N |
| XLogP | 4.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |