C16H16ClN3O — CID 59262504
5-[3-(2-chlorophenyl)phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 59262504) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 5-[3-(2-chlorophenyl)phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[3-(2-chlorophenyl)phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 59262504 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-[3-(2-chlorophenyl)phenyl]-2,5-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN1OC(C)(c2cccc(-c3ccccc3Cl)c2)N=C1N |
| InChI | InChI=1S/C16H16ClN3O/c1-16(19-15(18)20(2)21-16)12-7-5-6-11(10-12)13-8-3-4-9-14(13)17/h3-10H,1-2H3,(H2,18,19) |
| InChIKey | FSFZRVJGZKIINA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |