About 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione
3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione (PubChem CID 59262590) has the molecular formula C12H15N3OS2
and a molecular weight of 281.41 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione.
Molecular Properties
| Compound Name | 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione |
| PubChem CID | 59262590 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione |
| SMILES | CC1(c2ccccc2)NC(=S)N(OCCN)C1=S |
| InChI | InChI=1S/C12H15N3OS2/c1-12(9-5-3-2-4-6-9)10(17)15(11(18)14-12)16-8-7-13/h2-6H,7-8,13H2,1H3,(H,14,18) |
| InChIKey | WBECKOIZIAJWKG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione?
The IUPAC name of 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione (CID 59262590) is 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione.
What is the SMILES notation for 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione?
The canonical SMILES for 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione is CC1(c2ccccc2)NC(=S)N(OCCN)C1=S.
What is the InChIKey of 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione?
The InChIKey is WBECKOIZIAJWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS2/c1-12(9-5-3-2-4-6-9)10(17)15(11(18)14-12)16-8-7-13/h2-6H,7-8,13H2,1H3,(H,14,18).
What are the key properties of 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione?
3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione has a molecular weight of 281.41 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethoxy)-5-methyl-5-phenylimidazolidine-2,4-dithione is sourced from PubChem (CID 59262590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).