C22H25N5OS — CID 59262638
N-(3,5-dimethylphenyl)-4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-amine (PubChem CID 59262638) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-amine.
| Compound Name | N-(3,5-dimethylphenyl)-4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-amine |
|---|---|
| PubChem CID | 59262638 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-amine |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)-c2cc(CN4CCNCC4)sc2CO3)c1 |
| InChI | InChI=1S/C22H25N5OS/c1-14-7-15(2)9-16(8-14)25-22-24-11-19-21(26-22)18-10-17(29-20(18)13-28-19)12-27-5-3-23-4-6-27/h7-11,23H,3-6,12-13H2,1-2H3,(H,24,25,26) |
| InChIKey | OZTPLSQBHKZNRZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |