C20H22N6O3S2 — CID 59262658
3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide (PubChem CID 59262658) has the molecular formula C20H22N6O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 59262658 |
| Molecular Formula | C20H22N6O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-[[4-(piperazin-1-ylmethyl)-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncc3c(n2)-c2cc(CN4CCNCC4)sc2CO3)c1 |
| InChI | InChI=1S/C20H22N6O3S2/c21-31(27,28)15-3-1-2-13(8-15)24-20-23-10-17-19(25-20)16-9-14(30-18(16)12-29-17)11-26-6-4-22-5-7-26/h1-3,8-10,22H,4-7,11-12H2,(H2,21,27,28)(H,23,24,25) |
| InChIKey | PJVXNJPYXIMTSR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |