C25H26N6O2S — CID 59262740
[2-(4-morpholin-4-ylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone (PubChem CID 59262740) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-(4-morpholin-4-ylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 59262740 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc2c(ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nc32)s1)N1CCNCC1 |
| InChI | InChI=1S/C25H26N6O2S/c32-24(31-9-7-26-8-10-31)22-15-20-21(34-22)6-1-17-16-27-25(29-23(17)20)28-18-2-4-19(5-3-18)30-11-13-33-14-12-30/h1-6,15-16,26H,7-14H2,(H,27,28,29) |
| InChIKey | QOEOMPXKWIAVOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|