C20H20N6O3S3 — CID 59262776
3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide (PubChem CID 59262776) has the molecular formula C20H20N6O3S3 and a molecular weight of 488.62 g/mol. Its IUPAC name is 3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 59262776 |
| Molecular Formula | C20H20N6O3S3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncc3c(n2)-c2cc(C(=O)N4CCNCC4)sc2CS3)c1 |
| InChI | InChI=1S/C20H20N6O3S3/c21-32(28,29)13-3-1-2-12(8-13)24-20-23-10-16-18(25-20)14-9-15(31-17(14)11-30-16)19(27)26-6-4-22-5-7-26/h1-3,8-10,22H,4-7,11H2,(H2,21,28,29)(H,23,24,25) |
| InChIKey | MHCHJYSRLGJDAM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |