C24H36FNO6S — CID 59263228
4-[[1-[3-fluoro-5-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]methoxy]butane-1-sulfonic acid (PubChem CID 59263228) has the molecular formula C24H36FNO6S and a molecular weight of 485.62 g/mol. Its IUPAC name is 4-[[1-[3-fluoro-5-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]methoxy]butane-1-sulfonic acid.
| Compound Name | 4-[[1-[3-fluoro-5-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]methoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59263228 |
| Molecular Formula | C24H36FNO6S |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 4-[[1-[3-fluoro-5-[hydroxy-(1-propylcyclobutyl)methyl]phenyl]-6-oxopiperidin-2-yl]methoxy]butane-1-sulfonic acid |
| SMILES | CCCC1(C(O)c2cc(F)cc(N3C(=O)CCCC3COCCCCS(=O)(=O)O)c2)CCC1 |
| InChI | InChI=1S/C24H36FNO6S/c1-2-9-24(10-6-11-24)23(28)18-14-19(25)16-21(15-18)26-20(7-5-8-22(26)27)17-32-12-3-4-13-33(29,30)31/h14-16,20,23,28H,2-13,17H2,1H3,(H,29,30,31) |
| InChIKey | CCVRUVOICPNTMJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|