About N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide
N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 592634) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide |
| PubChem CID | 592634 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | CCCn1cnnc1C(C)NC(C)=O |
| InChI | InChI=1S/C9H16N4O/c1-4-5-13-6-10-12-9(13)7(2)11-8(3)14/h6-7H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | AULPYIFRKQIEER-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide?
The IUPAC name of N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide (CID 592634) is N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide?
The canonical SMILES for N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide is CCCn1cnnc1C(C)NC(C)=O.
What is the InChIKey of N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide?
The InChIKey is AULPYIFRKQIEER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-4-5-13-6-10-12-9(13)7(2)11-8(3)14/h6-7H,4-5H2,1-3H3,(H,11,14).
What are the key properties of N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide?
N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide has a molecular weight of 196.25 g/mol, XLogP of 0.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-propyl-1,2,4-triazol-3-yl)ethyl]acetamide is sourced from PubChem (CID 592634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).