About 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one
5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one (PubChem CID 59263479) has the molecular formula C20H19ClFNO2
and a molecular weight of 359.83 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one |
| PubChem CID | 59263479 |
| Molecular Formula | C20H19ClFNO2 |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc(F)c(Cl)cc32)c2ccccc21 |
| InChI | InChI=1S/C20H19ClFNO2/c1-2-3-6-9-23-17-8-5-4-7-13(17)20(19(23)24)12-25-18-11-16(22)15(21)10-14(18)20/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3 |
| InChIKey | PPWFSERJUPTWNR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The IUPAC name of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one (CID 59263479) is 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one.
What is the SMILES notation for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The canonical SMILES for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one is CCCCCN1C(=O)C2(COc3cc(F)c(Cl)cc32)c2ccccc21.
What is the InChIKey of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The InChIKey is PPWFSERJUPTWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClFNO2/c1-2-3-6-9-23-17-8-5-4-7-13(17)20(19(23)24)12-25-18-11-16(22)15(21)10-14(18)20/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3.
What are the key properties of 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one?
5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one has a molecular weight of 359.83 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-fluoro-1'-pentylspiro[2H-1-benzofuran-3,3'-indole]-2'-one is sourced from PubChem (CID 59263479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).