C16H10F8 — CID 59263560
1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 59263560) has the molecular formula C16H10F8 and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 59263560 |
| Molecular Formula | C16H10F8 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | CCc1c(F)c(F)c(-c2c(F)c(F)c(CC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H10F8/c1-3-5-9(17)13(21)7(14(22)10(5)18)8-15(23)11(19)6(4-2)12(20)16(8)24/h3-4H2,1-2H3 |
| InChIKey | WAIFSQTVZFVAHI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|