C21H33NO3 — CID 59263592
(4R,5S)-5-butyl-4-[(1E,3E,5Z,7E,9R)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-1,3-oxazolidin-2-one (PubChem CID 59263592) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is (4R,5S)-5-butyl-4-[(1E,3E,5Z,7E,9R)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-5-butyl-4-[(1E,3E,5Z,7E,9R)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59263592 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | (4R,5S)-5-butyl-4-[(1E,3E,5Z,7E,9R)-9-hydroxytetradeca-1,3,5,7-tetraenyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\C=C\C=C\[C@H]1NC(=O)O[C@H]1CCCC |
| InChI | InChI=1S/C21H33NO3/c1-3-5-11-14-18(23)15-12-9-7-8-10-13-16-19-20(17-6-4-2)25-21(24)22-19/h7-10,12-13,15-16,18-20,23H,3-6,11,14,17H2,1-2H3,(H,22,24)/b9-7-,10-8+,15-12+,16-13+/t18-,19-,20+/m1/s1 |
| InChIKey | KHDIDWZLSAZOGO-DGLDKMQUSA-N |
| XLogP | 4.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|