C25H26F6O3 — CID 59263691
(3E,5E)-6-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol (PubChem CID 59263691) has the molecular formula C25H26F6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is (3E,5E)-6-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol.
| Compound Name | (3E,5E)-6-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 59263691 |
| Molecular Formula | C25H26F6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (3E,5E)-6-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
| SMILES | CC/C(=C\C=C\C(O)(C(F)(F)F)C(F)(F)F)c1cccc(CCc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C25H26F6O3/c1-2-19(7-4-12-23(34,24(26,27)28)25(29,30)31)20-6-3-5-17(13-20)8-9-18-10-11-21(15-32)22(14-18)16-33/h3-7,10-14,32-34H,2,8-9,15-16H2,1H3/b12-4+,19-7+ |
| InChIKey | GDMSFPQHUTVPQR-XFNPMVETSA-N |
| XLogP | 5.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|