C24H24F6O4 — CID 59263692
(3E,5E)-6-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol (PubChem CID 59263692) has the molecular formula C24H24F6O4 and a molecular weight of 490.44 g/mol. Its IUPAC name is (3E,5E)-6-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol.
| Compound Name | (3E,5E)-6-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 59263692 |
| Molecular Formula | C24H24F6O4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (3E,5E)-6-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)octa-3,5-dien-2-ol |
| SMILES | CC/C(=C\C=C\C(O)(C(F)(F)F)C(F)(F)F)c1cccc(OCc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C24H24F6O4/c1-2-17(6-4-10-22(33,23(25,26)27)24(28,29)30)18-5-3-7-21(12-18)34-15-16-8-9-19(13-31)20(11-16)14-32/h3-12,31-33H,2,13-15H2,1H3/b10-4+,17-6+ |
| InChIKey | GTLCUSKTPJNTRH-YNXPHOCQSA-N |
| XLogP | 5.46 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|