C25H45NO2 — CID 59263699
1-methyl-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrolidine-2,5-dione (PubChem CID 59263699) has the molecular formula C25H45NO2 and a molecular weight of 391.64 g/mol. Its IUPAC name is 1-methyl-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59263699 |
| Molecular Formula | C25H45NO2 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.35 |
| IUPAC Name | 1-methyl-3-(2,4,4,6,6,8,8,10,10-nonamethylundec-1-en-3-yl)pyrrolidine-2,5-dione |
| SMILES | C=C(C)C(C1CC(=O)N(C)C1=O)C(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C25H45NO2/c1-17(2)20(18-13-19(27)26(12)21(18)28)25(10,11)16-24(8,9)15-23(6,7)14-22(3,4)5/h18,20H,1,13-16H2,2-12H3 |
| InChIKey | IHXMHCSNFHJJJZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|