C21H29F3O3S — CID 59263729
[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 59263729) has the molecular formula C21H29F3O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59263729 |
| Molecular Formula | C21H29F3O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(OS(=O)(=O)C(F)(F)F)=CCC32)C1 |
| InChI | InChI=1S/C21H29F3O3S/c1-13-8-10-19(2)14(12-13)4-5-15-16-6-7-18(20(16,3)11-9-17(15)19)27-28(25,26)21(22,23)24/h4,7,13,15-17H,5-6,8-12H2,1-3H3/t13-,15?,16?,17?,19-,20-/m0/s1 |
| InChIKey | LAEKNEUPKAOBMK-WCQRSGRZSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|