C54H68O2 — CID 59263993
1,5-bis[4-(3,7-dimethyloctoxy)phenyl]-2-methyl-6-[(E)-2-[4-[(E)-prop-1-enyl]phenyl]ethenyl]naphthalene (PubChem CID 59263993) has the molecular formula C54H68O2 and a molecular weight of 749.14 g/mol. Its IUPAC name is 1,5-bis[4-(3,7-dimethyloctoxy)phenyl]-2-methyl-6-[(E)-2-[4-[(E)-prop-1-enyl]phenyl]ethenyl]naphthalene.
| Compound Name | 1,5-bis[4-(3,7-dimethyloctoxy)phenyl]-2-methyl-6-[(E)-2-[4-[(E)-prop-1-enyl]phenyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 59263993 |
| Molecular Formula | C54H68O2 |
| Molecular Weight | 749.14 g/mol |
| Exact Mass | 748.52 |
| IUPAC Name | 1,5-bis[4-(3,7-dimethyloctoxy)phenyl]-2-methyl-6-[(E)-2-[4-[(E)-prop-1-enyl]phenyl]ethenyl]naphthalene |
| SMILES | C/C=C/c1ccc(/C=C/c2ccc3c(-c4ccc(OCCC(C)CCCC(C)C)cc4)c(C)ccc3c2-c2ccc(OCCC(C)CCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C54H68O2/c1-9-12-44-18-20-45(21-19-44)22-23-47-28-34-51-52(54(47)48-26-31-50(32-27-48)56-38-36-42(7)16-11-14-40(4)5)33-17-43(8)53(51)46-24-29-49(30-25-46)55-37-35-41(6)15-10-13-39(2)3/h9,12,17-34,39-42H,10-11,13-16,35-38H2,1-8H3/b12-9+,23-22+ |
| InChIKey | MBHMNBCWYURUCR-BKTXWKQLSA-N |
| XLogP | 16.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.14 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|