C28H39BrOSi — CID 59264428
[(1R,3R)-3-[(E)-3-bromoprop-1-enyl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59264428) has the molecular formula C28H39BrOSi and a molecular weight of 499.61 g/mol. Its IUPAC name is [(1R,3R)-3-[(E)-3-bromoprop-1-enyl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,3R)-3-[(E)-3-bromoprop-1-enyl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59264428 |
| Molecular Formula | C28H39BrOSi |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [(1R,3R)-3-[(E)-3-bromoprop-1-enyl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@]1(C)/C=C/CBr |
| InChI | InChI=1S/C28H39BrOSi/c1-26(2,3)31(24-14-9-7-10-15-24,25-16-11-8-12-17-25)30-22-23-18-20-28(6,19-13-21-29)27(23,4)5/h7-17,19,23H,18,20-22H2,1-6H3/b19-13+/t23-,28-/m0/s1 |
| InChIKey | ASUCVQGPBOHRHB-UENCKYPXSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|