C29H42OSi — CID 59264433
[(1R,3R)-3-[(2S)-but-3-en-2-yl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59264433) has the molecular formula C29H42OSi and a molecular weight of 434.74 g/mol. Its IUPAC name is [(1R,3R)-3-[(2S)-but-3-en-2-yl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,3R)-3-[(2S)-but-3-en-2-yl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59264433 |
| Molecular Formula | C29H42OSi |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | [(1R,3R)-3-[(2S)-but-3-en-2-yl]-2,2,3-trimethylcyclopentyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=C[C@H](C)[C@@]1(C)CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C29H42OSi/c1-9-23(2)29(8)21-20-24(28(29,6)7)22-30-31(27(3,4)5,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h9-19,23-24H,1,20-22H2,2-8H3/t23-,24-,29+/m0/s1 |
| InChIKey | QUESGTHBASFIKC-NDIVSWGXSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|