C15H21NO2 — CID 59264599
7-tert-butyl-2,2,4-trimethyl-1,4-benzoxazin-3-one (PubChem CID 59264599) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 7-tert-butyl-2,2,4-trimethyl-1,4-benzoxazin-3-one.
| Compound Name | 7-tert-butyl-2,2,4-trimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59264599 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 7-tert-butyl-2,2,4-trimethyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)C(C)(C)Oc2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C15H21NO2/c1-14(2,3)10-7-8-11-12(9-10)18-15(4,5)13(17)16(11)6/h7-9H,1-6H3 |
| InChIKey | MSANAZSCSCIHAM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |