C31H54O6Si — CID 59265205
methyl (4Z,7Z,10Z,15E)-13-acetyl-17-[tert-butyl(dimethyl)silyl]oxy-14-(2-hydroxy-1-methoxyethyl)nonadeca-4,7,10,15-tetraenoate (PubChem CID 59265205) has the molecular formula C31H54O6Si and a molecular weight of 550.85 g/mol. Its IUPAC name is methyl (4Z,7Z,10Z,15E)-13-acetyl-17-[tert-butyl(dimethyl)silyl]oxy-14-(2-hydroxy-1-methoxyethyl)nonadeca-4,7,10,15-tetraenoate.
| Compound Name | methyl (4Z,7Z,10Z,15E)-13-acetyl-17-[tert-butyl(dimethyl)silyl]oxy-14-(2-hydroxy-1-methoxyethyl)nonadeca-4,7,10,15-tetraenoate |
|---|---|
| PubChem CID | 59265205 |
| Molecular Formula | C31H54O6Si |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | methyl (4Z,7Z,10Z,15E)-13-acetyl-17-[tert-butyl(dimethyl)silyl]oxy-14-(2-hydroxy-1-methoxyethyl)nonadeca-4,7,10,15-tetraenoate |
| SMILES | CCC(/C=C/C(C(CO)OC)C(C/C=C\C/C=C\C/C=C\CCC(=O)OC)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O6Si/c1-10-26(37-38(8,9)31(3,4)5)22-23-28(29(24-32)35-6)27(25(2)33)20-18-16-14-12-11-13-15-17-19-21-30(34)36-7/h11-12,15-18,22-23,26-29,32H,10,13-14,19-21,24H2,1-9H3/b12-11-,17-15-,18-16-,23-22+ |
| InChIKey | AJSJERHINCVUKL-WREXMLSUSA-N |
| XLogP | 6.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|