C20H30O5 — CID 59265208
methyl (4Z,7Z,10Z,13Z)-13-acetyl-16-hydroxy-15-methoxyhexadeca-4,7,10,13-tetraenoate (PubChem CID 59265208) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl (4Z,7Z,10Z,13Z)-13-acetyl-16-hydroxy-15-methoxyhexadeca-4,7,10,13-tetraenoate.
| Compound Name | methyl (4Z,7Z,10Z,13Z)-13-acetyl-16-hydroxy-15-methoxyhexadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 59265208 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl (4Z,7Z,10Z,13Z)-13-acetyl-16-hydroxy-15-methoxyhexadeca-4,7,10,13-tetraenoate |
| SMILES | COC(=O)CC/C=C\C/C=C\C/C=C\C/C(=C/C(CO)OC)C(C)=O |
| InChI | InChI=1S/C20H30O5/c1-17(22)18(15-19(16-21)24-2)13-11-9-7-5-4-6-8-10-12-14-20(23)25-3/h4-5,8-11,15,19,21H,6-7,12-14,16H2,1-3H3/b5-4-,10-8-,11-9-,18-15- |
| InChIKey | PAFCEGVYVKEOHC-IJYCNQRNSA-N |
| XLogP | 3.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|