C28H32Cl2N3O3+ — CID 59265755
[4-[(3S)-4-[(3,4-dichlorophenyl)methyl]-3-methoxypiperidin-1-yl]piperidin-1-yl]-(1-hydroxyquinolin-1-ium-6-yl)methanone (PubChem CID 59265755) has the molecular formula C28H32Cl2N3O3+ and a molecular weight of 529.49 g/mol. Its IUPAC name is [4-[(3S)-4-[(3,4-dichlorophenyl)methyl]-3-methoxypiperidin-1-yl]piperidin-1-yl]-(1-hydroxyquinolin-1-ium-6-yl)methanone.
| Compound Name | [4-[(3S)-4-[(3,4-dichlorophenyl)methyl]-3-methoxypiperidin-1-yl]piperidin-1-yl]-(1-hydroxyquinolin-1-ium-6-yl)methanone |
|---|---|
| PubChem CID | 59265755 |
| Molecular Formula | C28H32Cl2N3O3+ |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [4-[(3S)-4-[(3,4-dichlorophenyl)methyl]-3-methoxypiperidin-1-yl]piperidin-1-yl]-(1-hydroxyquinolin-1-ium-6-yl)methanone |
| SMILES | CO[C@@H]1CN(C2CCN(C(=O)c3ccc4c(ccc[n+]4O)c3)CC2)CCC1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H32Cl2N3O3/c1-36-27-18-32(12-8-21(27)15-19-4-6-24(29)25(30)16-19)23-9-13-31(14-10-23)28(34)22-5-7-26-20(17-22)3-2-11-33(26)35/h2-7,11,16-17,21,23,27,35H,8-10,12-15,18H2,1H3/q+1/t21?,27-/m1/s1 |
| InChIKey | ZNSLIAWIALLZPZ-IAIRZMIISA-N |
| XLogP | 4.86 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|