C27H22N4 — CID 59266205
3-[4-[3,5-bis(4-methylphenyl)-1,2,4-triazol-4-yl]phenyl]pyridine (PubChem CID 59266205) has the molecular formula C27H22N4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[4-[3,5-bis(4-methylphenyl)-1,2,4-triazol-4-yl]phenyl]pyridine.
| Compound Name | 3-[4-[3,5-bis(4-methylphenyl)-1,2,4-triazol-4-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 59266205 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-[4-[3,5-bis(4-methylphenyl)-1,2,4-triazol-4-yl]phenyl]pyridine |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(C)cc3)n2-c2ccc(-c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C27H22N4/c1-19-5-9-22(10-6-19)26-29-30-27(23-11-7-20(2)8-12-23)31(26)25-15-13-21(14-16-25)24-4-3-17-28-18-24/h3-18H,1-2H3 |
| InChIKey | OOSBIFQNJLWNCU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |