C19H15NO — CID 59266301
N-(3,4-diethynylphenyl)-3,5-dimethylbenzamide (PubChem CID 59266301) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is N-(3,4-diethynylphenyl)-3,5-dimethylbenzamide.
| Compound Name | N-(3,4-diethynylphenyl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 59266301 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(3,4-diethynylphenyl)-3,5-dimethylbenzamide |
| SMILES | C#Cc1ccc(NC(=O)c2cc(C)cc(C)c2)cc1C#C |
| InChI | InChI=1S/C19H15NO/c1-5-15-7-8-18(12-16(15)6-2)20-19(21)17-10-13(3)9-14(4)11-17/h1-2,7-12H,3-4H3,(H,20,21) |
| InChIKey | KBJGEWOMSZAIPR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|